![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[DIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | southern blotting protocols/ | 28-Feb-2015 12:04 | - | |
| protein protocols/ | 28-Feb-2015 12:04 | - | |
| openlab/ | 28-Feb-2015 12:04 | - | |
| live animal protocols/ | 28-Feb-2015 12:04 | - | |
| kinase and phosphatase assays/ | 28-Feb-2015 12:04 | - | |
| immunoprecipitation and western blotting/ | 28-Feb-2015 12:04 | - | |
| images/ | 28-Feb-2015 12:04 | - | |
| histology and staining/ | 28-Feb-2015 12:04 | - | |
| genotyping/ | 28-Feb-2015 12:04 | - | |
| error analysis/ | 28-Feb-2015 12:04 | - | |
| bacterial protocols/ | 28-Feb-2015 12:04 | - | |
| adenovirus protocols/ | 28-Feb-2015 12:04 | - | |
| _vti_cnf/ | 28-Feb-2015 12:04 | - | |
| _notes/ | 28-Feb-2015 12:04 | - | |
![[ ]](/icons/unknown.gif) | Recombinant Protein Expression.doc | 17-Mar-2015 14:11 | 97K | |
| PCR Protocols/ | 28-Feb-2015 12:04 | - | |
| Molecular Biology Protocols/ | 28-Feb-2015 12:04 | - | |
| Mammalian Cell culture and manipulations/ | 28-Feb-2015 12:04 | - | |
| Hormone Assays/ | 28-Feb-2015 12:04 | - | |
| Genespring/ | 28-Feb-2015 12:04 | - | |
| DNA RNA isolation and analysis protocols/ | 28-Feb-2015 12:04 | - | |
|
|---|