![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| ACTIVATION OF p70s6k and MAP KINASES.htm | 17-Mar-2015 14:11 | 19K | |
| Akt PKB kinase assay.htm | 17-Mar-2015 14:11 | 14K | |
| In Vitro MAP kinase assay 9.htm | 17-Mar-2015 14:11 | 9.0K | |
| In_vitro kinase assay for JNK-1 IRS proteins.htm | 17-Mar-2015 14:11 | 16K | |
| JNK Kinase Assay.htm | 17-Mar-2015 14:11 | 6.0K | |
| JNK Kinase Assay LRui.htm | 17-Mar-2015 14:11 | 4.1K | |
| WGA-IR autophosphorylation.htm | 17-Mar-2015 14:11 | 9.7K | |
| WGA-IR phosphorylation of IRS-1bac.htm | 17-Mar-2015 14:11 | 10K | |
| _derived/ | 28-Feb-2015 12:04 | - | |
| _notes/ | 28-Feb-2015 12:04 | - | |
| _vti_cnf/ | 28-Feb-2015 12:04 | - | |