![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[DIR]](/icons/back.gif) | Parent Directory | | - | |
![[TXT]](/icons/text.gif) | Isolation of total RNA from mouse muscle.htm | 17-Mar-2015 14:10 | 4.2K | |
| Preparation of CsCl-purified DNA (large prep).htm | 17-Mar-2015 14:10 | 18K | |
| Preparation of Herring Sperm DNA for Southern Blotting--carrie.htm | 17-Mar-2015 14:10 | 4.3K | |
| Probe DNA Preps - clf.htm | 17-Mar-2015 14:10 | 39K | |
| SDS page--7.5% polyacrylamide gel.htm | 17-Mar-2015 14:10 | 26K | |
| Southern Protocol revised for Shari--carrie.htm | 17-Mar-2015 14:10 | 21K | |
| Synthesis of Double.htm | 17-Mar-2015 14:10 | 14K | |
| Turning Oligos into Linkers.htm | 17-Mar-2015 14:10 | 3.9K | |
![[DIR]](/icons/folder.gif) | _derived/ | 28-Feb-2015 12:04 | - | |
| _notes/ | 28-Feb-2015 12:04 | - | |
| _vti_cnf/ | 28-Feb-2015 12:04 | - | |
| phenol-chloroform extraction protocol--Carrie.htm | 17-Mar-2015 14:10 | 10K | |
|
|---|